ChemNet > CAS > 58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
نام محصول |
3-aminothieno[2,3-b]pyridine-2-carboxylic acid |
مترادف |
3-Aminothieno(2,3-b)pyridine-2-carboxylic acid; NSC 284503 |
میدان مغناطیسی |
C8H6N2O2S |
وزن مولکولی |
194.2104 |
InChI |
InChI=1/C8H6N2O2S/c9-5-4-2-1-3-10-7(4)13-6(5)8(11)12/h1-3H,9H2,(H,11,12) |
شماره سیایاس |
58327-75-6 |
ساختار مولکولی |
|
تراکم |
1.604g/cm3 |
نقطه ذوب |
278℃ |
نقطه غلیان |
453.3°C at 760 mmHg |
ضریب شکست |
1.799 |
نقطه اشتعال |
228°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|